C54H43BN6O2 — CID 123801624
2-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 123801624) has the molecular formula C54H43BN6O2 and a molecular weight of 818.79 g/mol. Its IUPAC name is 2-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 123801624 |
| Molecular Formula | C54H43BN6O2 |
| Molecular Weight | 818.79 g/mol |
| Exact Mass | 818.35 |
| IUPAC Name | 2-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C54H43BN6O2/c1-53(2)54(3,4)63-55(62-53)46-34-44(40-27-17-29-42(31-40)51-58-47(36-19-9-5-10-20-36)56-48(59-51)37-21-11-6-12-22-37)33-45(35-46)41-28-18-30-43(32-41)52-60-49(38-23-13-7-14-24-38)57-50(61-52)39-25-15-8-16-26-39/h5-35H,1-4H3 |
| InChIKey | SSWMGSVBIKHDKG-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.79 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|