C14H18N2O5 — CID 123801752
8-amino-4-(4-methoxy-4-oxobutyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 123801752) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 8-amino-4-(4-methoxy-4-oxobutyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 8-amino-4-(4-methoxy-4-oxobutyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 123801752 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 8-amino-4-(4-methoxy-4-oxobutyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | COC(=O)CCCN1CC(C(=O)O)Oc2c(N)cccc21 |
| InChI | InChI=1S/C14H18N2O5/c1-20-12(17)6-3-7-16-8-11(14(18)19)21-13-9(15)4-2-5-10(13)16/h2,4-5,11H,3,6-8,15H2,1H3,(H,18,19) |
| InChIKey | DGJHVTCONWSGCC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|