C15H33F5O7Si3 — CID 123801798
[1,1,1,2-tetrafluoro-4-[methyl-bis(2-trimethoxysilylethyl)silyl]butan-2-yl] hypofluorite (PubChem CID 123801798) has the molecular formula C15H33F5O7Si3 and a molecular weight of 504.67 g/mol. Its IUPAC name is [1,1,1,2-tetrafluoro-4-[methyl-bis(2-trimethoxysilylethyl)silyl]butan-2-yl] hypofluorite.
| Compound Name | [1,1,1,2-tetrafluoro-4-[methyl-bis(2-trimethoxysilylethyl)silyl]butan-2-yl] hypofluorite |
|---|---|
| PubChem CID | 123801798 |
| Molecular Formula | C15H33F5O7Si3 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | [1,1,1,2-tetrafluoro-4-[methyl-bis(2-trimethoxysilylethyl)silyl]butan-2-yl] hypofluorite |
| SMILES | CO[Si](CC[Si](C)(CCC(F)(OF)C(F)(F)F)CC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C15H33F5O7Si3/c1-21-29(22-2,23-3)12-10-28(7,11-13-30(24-4,25-5)26-6)9-8-14(16,27-20)15(17,18)19/h8-13H2,1-7H3 |
| InChIKey | XELXDLZOCCCXTN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|