C26H28F2N6O — CID 123802327
1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[(2-pyrazin-2-yl-2,7-diazaspiro[4.4]nonan-7-yl)methyl]-2-pyridinyl]methanimine (PubChem CID 123802327) has the molecular formula C26H28F2N6O and a molecular weight of 478.55 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[(2-pyrazin-2-yl-2,7-diazaspiro[4.4]nonan-7-yl)methyl]-2-pyridinyl]methanimine.
| Compound Name | 1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[(2-pyrazin-2-yl-2,7-diazaspiro[4.4]nonan-7-yl)methyl]-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 123802327 |
| Molecular Formula | C26H28F2N6O |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[(2-pyrazin-2-yl-2,7-diazaspiro[4.4]nonan-7-yl)methyl]-2-pyridinyl]methanimine |
| SMILES | CCON=C(c1ccc(F)c(F)c1)c1ccc(CN2CCC3(CCN(c4cnccn4)C3)C2)cn1 |
| InChI | InChI=1S/C26H28F2N6O/c1-2-35-32-25(20-4-5-21(27)22(28)13-20)23-6-3-19(14-31-23)16-33-11-7-26(17-33)8-12-34(18-26)24-15-29-9-10-30-24/h3-6,9-10,13-15H,2,7-8,11-12,16-18H2,1H3 |
| InChIKey | ZLVXFRKDBYNZQF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|