C9H14N4O2S — CID 123802335
2-[2-(1,1-dioxothiolan-3-yl)-1,2,4-triazol-3-yl]propan-1-imine (PubChem CID 123802335) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-[2-(1,1-dioxothiolan-3-yl)-1,2,4-triazol-3-yl]propan-1-imine.
| Compound Name | 2-[2-(1,1-dioxothiolan-3-yl)-1,2,4-triazol-3-yl]propan-1-imine |
|---|---|
| PubChem CID | 123802335 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-[2-(1,1-dioxothiolan-3-yl)-1,2,4-triazol-3-yl]propan-1-imine |
| SMILES | [H]/N=C/C(C)c1ncnn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H14N4O2S/c1-7(4-10)9-11-6-12-13(9)8-2-3-16(14,15)5-8/h4,6-8,10H,2-3,5H2,1H3/b10-4+ |
| InChIKey | VBGTYDWGHNLGHZ-ONNFQVAWSA-N |
| XLogP | 0.39 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|