C13H26N2O2 — CID 123803156
2,2-diethyl-N,N',4,4-tetramethylpentanediamide (PubChem CID 123803156) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2,2-diethyl-N,N',4,4-tetramethylpentanediamide.
| Compound Name | 2,2-diethyl-N,N',4,4-tetramethylpentanediamide |
|---|---|
| PubChem CID | 123803156 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2,2-diethyl-N,N',4,4-tetramethylpentanediamide |
| SMILES | CCC(CC)(CC(C)(C)C(=O)NC)C(=O)NC |
| InChI | InChI=1S/C13H26N2O2/c1-7-13(8-2,11(17)15-6)9-12(3,4)10(16)14-5/h7-9H2,1-6H3,(H,14,16)(H,15,17) |
| InChIKey | DOJCJLPRPBNZDU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |