About (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate
(2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 123803263) has the molecular formula C19H37NO4
and a molecular weight of 343.51 g/mol. Its IUPAC name is (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate |
| PubChem CID | 123803263 |
| Molecular Formula | C19H37NO4 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCC(O)CN1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C19H37NO4/c1-17(2,3)14-19(7,18(4,5)6)16(22)24-13-15(21)12-20-8-10-23-11-9-20/h15,21H,8-14H2,1-7H3 |
| InChIKey | JIPJCFUOIZTPPH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
The IUPAC name of (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate (CID 123803263) is (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate.
What is the SMILES notation for (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
The canonical SMILES for (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate is CC(C)(C)CC(C)(C(=O)OCC(O)CN1CCOCC1)C(C)(C)C.
What is the InChIKey of (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
The InChIKey is JIPJCFUOIZTPPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37NO4/c1-17(2,3)14-19(7,18(4,5)6)16(22)24-13-15(21)12-20-8-10-23-11-9-20/h15,21H,8-14H2,1-7H3.
What are the key properties of (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
(2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate has a molecular weight of 343.51 g/mol, XLogP of 2.71, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-3-morpholin-4-ylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate is sourced from PubChem (CID 123803263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).