C14H24N2O3 — CID 123803320
but-2-en-2-yl N-(3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)carbamate (PubChem CID 123803320) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is but-2-en-2-yl N-(3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)carbamate.
| Compound Name | but-2-en-2-yl N-(3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 123803320 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | but-2-en-2-yl N-(3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)carbamate |
| SMILES | CC=C(C)OC(=O)NC(C(=O)N1CCCC1)C(C)C |
| InChI | InChI=1S/C14H24N2O3/c1-5-11(4)19-14(18)15-12(10(2)3)13(17)16-8-6-7-9-16/h5,10,12H,6-9H2,1-4H3,(H,15,18) |
| InChIKey | YWZQAHIJTNUCBY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|