C21H37NO — CID 123803411
7-methyl-N-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]octa-2,6-dien-1-amine (PubChem CID 123803411) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is 7-methyl-N-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]octa-2,6-dien-1-amine.
| Compound Name | 7-methyl-N-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]octa-2,6-dien-1-amine |
|---|---|
| PubChem CID | 123803411 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | 7-methyl-N-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]octa-2,6-dien-1-amine |
| SMILES | CC(C)=CCCC=CCNCCOC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C21H37NO/c1-17(2)10-8-6-7-9-13-22-14-15-23-19-16-18-11-12-21(19,5)20(18,3)4/h7,9-10,18-19,22H,6,8,11-16H2,1-5H3 |
| InChIKey | ZMRMXYPVQRSRMK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|