About (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol
(4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol (PubChem CID 123803446) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol.
Molecular Properties
| Compound Name | (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol |
| PubChem CID | 123803446 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol |
| SMILES | C=CC(=C)/C=C/C(/C=N/C)C(C)O |
| InChI | InChI=1S/C11H17NO/c1-5-9(2)6-7-11(8-12-4)10(3)13/h5-8,10-11,13H,1-2H2,3-4H3/b7-6+,12-8+ |
| InChIKey | QJAIWIBFHYTQJR-ZYUHXDNHSA-N |
| XLogP | 1.98 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol?
The IUPAC name of (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol (CID 123803446) is (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol.
What is the SMILES notation for (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol?
The canonical SMILES for (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol is C=CC(=C)/C=C/C(/C=N/C)C(C)O.
What is the InChIKey of (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol?
The InChIKey is QJAIWIBFHYTQJR-ZYUHXDNHSA-N. The full InChI is InChI=1S/C11H17NO/c1-5-9(2)6-7-11(8-12-4)10(3)13/h5-8,10-11,13H,1-2H2,3-4H3/b7-6+,12-8+.
What are the key properties of (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol?
(4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol has a molecular weight of 179.26 g/mol, XLogP of 1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-6-methylidene-3-(methyliminomethyl)octa-4,7-dien-2-ol is sourced from PubChem (CID 123803446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).