About 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine
3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine (PubChem CID 123803731) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine.
Molecular Properties
| Compound Name | 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine |
| PubChem CID | 123803731 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine |
| SMILES | CCN1C=CCOC1C |
| InChI | InChI=1S/C7H13NO/c1-3-8-5-4-6-9-7(8)2/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | WILQQUADNPRJPI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine?
The IUPAC name of 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine (CID 123803731) is 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine.
What is the SMILES notation for 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine?
The canonical SMILES for 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine is CCN1C=CCOC1C.
What is the InChIKey of 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine?
The InChIKey is WILQQUADNPRJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-3-8-5-4-6-9-7(8)2/h4-5,7H,3,6H2,1-2H3.
What are the key properties of 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine?
3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine has a molecular weight of 127.19 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-methyl-2,6-dihydro-1,3-oxazine is sourced from PubChem (CID 123803731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).