About 1-penta-1,3-dien-2-ylpiperidine
1-penta-1,3-dien-2-ylpiperidine (PubChem CID 123803874) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-penta-1,3-dien-2-ylpiperidine.
Molecular Properties
| Compound Name | 1-penta-1,3-dien-2-ylpiperidine |
| PubChem CID | 123803874 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-penta-1,3-dien-2-ylpiperidine |
| SMILES | C=C(C=CC)N1CCCCC1 |
| InChI | InChI=1S/C10H17N/c1-3-7-10(2)11-8-5-4-6-9-11/h3,7H,2,4-6,8-9H2,1H3 |
| InChIKey | NIXNWQTYRJEURO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-penta-1,3-dien-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-penta-1,3-dien-2-ylpiperidine?
The IUPAC name of 1-penta-1,3-dien-2-ylpiperidine (CID 123803874) is 1-penta-1,3-dien-2-ylpiperidine.
What is the SMILES notation for 1-penta-1,3-dien-2-ylpiperidine?
The canonical SMILES for 1-penta-1,3-dien-2-ylpiperidine is C=C(C=CC)N1CCCCC1.
What is the InChIKey of 1-penta-1,3-dien-2-ylpiperidine?
The InChIKey is NIXNWQTYRJEURO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-3-7-10(2)11-8-5-4-6-9-11/h3,7H,2,4-6,8-9H2,1H3.
What are the key properties of 1-penta-1,3-dien-2-ylpiperidine?
1-penta-1,3-dien-2-ylpiperidine has a molecular weight of 151.25 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-penta-1,3-dien-2-ylpiperidine is sourced from PubChem (CID 123803874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).