About 3-hepta-2,4-dienylimino-N-methylpentan-1-amine
3-hepta-2,4-dienylimino-N-methylpentan-1-amine (PubChem CID 123804230) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 3-hepta-2,4-dienylimino-N-methylpentan-1-amine.
Molecular Properties
| Compound Name | 3-hepta-2,4-dienylimino-N-methylpentan-1-amine |
| PubChem CID | 123804230 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 3-hepta-2,4-dienylimino-N-methylpentan-1-amine |
| SMILES | CCC=CC=CC/N=C(\CC)CCNC |
| InChI | InChI=1S/C13H24N2/c1-4-6-7-8-9-11-15-13(5-2)10-12-14-3/h6-9,14H,4-5,10-12H2,1-3H3/b7-6?,9-8?,15-13+ |
| InChIKey | SQRPSQHHCFRVBW-VUNKPPDRSA-N |
| XLogP | 2.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-hepta-2,4-dienylimino-N-methylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hepta-2,4-dienylimino-N-methylpentan-1-amine?
The IUPAC name of 3-hepta-2,4-dienylimino-N-methylpentan-1-amine (CID 123804230) is 3-hepta-2,4-dienylimino-N-methylpentan-1-amine.
What is the SMILES notation for 3-hepta-2,4-dienylimino-N-methylpentan-1-amine?
The canonical SMILES for 3-hepta-2,4-dienylimino-N-methylpentan-1-amine is CCC=CC=CC/N=C(\CC)CCNC.
What is the InChIKey of 3-hepta-2,4-dienylimino-N-methylpentan-1-amine?
The InChIKey is SQRPSQHHCFRVBW-VUNKPPDRSA-N. The full InChI is InChI=1S/C13H24N2/c1-4-6-7-8-9-11-15-13(5-2)10-12-14-3/h6-9,14H,4-5,10-12H2,1-3H3/b7-6?,9-8?,15-13+.
What are the key properties of 3-hepta-2,4-dienylimino-N-methylpentan-1-amine?
3-hepta-2,4-dienylimino-N-methylpentan-1-amine has a molecular weight of 208.35 g/mol, XLogP of 2.97, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hepta-2,4-dienylimino-N-methylpentan-1-amine is sourced from PubChem (CID 123804230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).