C16H25N — CID 123804455
(5E)-5-ethyl-2,8,9-trimethyl-3-methylidenedeca-1,5,8-trien-4-imine (PubChem CID 123804455) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (5E)-5-ethyl-2,8,9-trimethyl-3-methylidenedeca-1,5,8-trien-4-imine.
| Compound Name | (5E)-5-ethyl-2,8,9-trimethyl-3-methylidenedeca-1,5,8-trien-4-imine |
|---|---|
| PubChem CID | 123804455 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (5E)-5-ethyl-2,8,9-trimethyl-3-methylidenedeca-1,5,8-trien-4-imine |
| SMILES | [H]N=C(C(=C)C(=C)C)/C(=C/CC(C)=C(C)C)CC |
| InChI | InChI=1S/C16H25N/c1-8-15(10-9-13(6)11(2)3)16(17)14(7)12(4)5/h10,17H,4,7-9H2,1-3,5-6H3/b15-10+,17-16+ |
| InChIKey | SYHGNVJYNOXWAH-NRQQLHKUSA-N |
| XLogP | 5.22 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|