C29H31N2+ — CID 123804469
1-[1-(6,7-dihydronaphthalen-1-yl)prop-2-ynyl]-3-[1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-4,5-dihydroimidazol-1-ium (PubChem CID 123804469) has the molecular formula C29H31N2+ and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-[1-(6,7-dihydronaphthalen-1-yl)prop-2-ynyl]-3-[1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-4,5-dihydroimidazol-1-ium.
| Compound Name | 1-[1-(6,7-dihydronaphthalen-1-yl)prop-2-ynyl]-3-[1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 123804469 |
| Molecular Formula | C29H31N2+ |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 1-[1-(6,7-dihydronaphthalen-1-yl)prop-2-ynyl]-3-[1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-4,5-dihydroimidazol-1-ium |
| SMILES | C#CC(c1cccc2c1=CCCC=2)[N+]1=CN(C(C)C2=c3ccccc3=CC(C)C2)CC1 |
| InChI | InChI=1S/C29H31N2/c1-4-29(27-15-9-12-23-10-5-7-13-25(23)27)31-17-16-30(20-31)22(3)28-19-21(2)18-24-11-6-8-14-26(24)28/h1,6,8-15,18,20-22,29H,5,7,16-17,19H2,2-3H3/q+1 |
| InChIKey | LOJDBMRKNJHTRF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|