C19H19Cl2NO4 — CID 123804605
2-[[(6R,7R)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methoxy]benzoic acid (PubChem CID 123804605) has the molecular formula C19H19Cl2NO4 and a molecular weight of 396.27 g/mol. Its IUPAC name is 2-[[(6R,7R)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methoxy]benzoic acid.
| Compound Name | 2-[[(6R,7R)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 123804605 |
| Molecular Formula | C19H19Cl2NO4 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-[[(6R,7R)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methoxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1OC[C@@H]1OCCNC[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2NO4/c20-15-6-5-12(9-16(15)21)14-10-22-7-8-25-18(14)11-26-17-4-2-1-3-13(17)19(23)24/h1-6,9,14,18,22H,7-8,10-11H2,(H,23,24)/t14-,18-/m0/s1 |
| InChIKey | PZJIFBXEICLPJR-KSSFIOAISA-N |
| XLogP | 3.84 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |