C38H49N3O6Si — CID 123804700
methyl 4-[4-[3-[5-[hydroxy-(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]-3,3-dimethyl-1,3-azasilolidin-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl]benzoate (PubChem CID 123804700) has the molecular formula C38H49N3O6Si and a molecular weight of 671.91 g/mol. Its IUPAC name is methyl 4-[4-[3-[5-[hydroxy-(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]-3,3-dimethyl-1,3-azasilolidin-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl]benzoate.
| Compound Name | methyl 4-[4-[3-[5-[hydroxy-(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]-3,3-dimethyl-1,3-azasilolidin-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl]benzoate |
|---|---|
| PubChem CID | 123804700 |
| Molecular Formula | C38H49N3O6Si |
| Molecular Weight | 671.91 g/mol |
| Exact Mass | 671.34 |
| IUPAC Name | methyl 4-[4-[3-[5-[hydroxy-(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]-3,3-dimethyl-1,3-azasilolidin-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(CC(NC(=O)OC(C)(C)C)C(=O)N3C[Si](C)(C)CC3C(O)NC3CCCc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C38H49N3O6Si/c1-38(2,3)47-37(45)40-32(22-25-14-16-26(17-15-25)27-18-20-29(21-19-27)36(44)46-4)35(43)41-24-48(5,6)23-33(41)34(42)39-31-13-9-11-28-10-7-8-12-30(28)31/h7-8,10,12,14-21,31-34,39,42H,9,11,13,22-24H2,1-6H3,(H,40,45) |
| InChIKey | UFGOHYKHINJZEJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.91 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|