C19H16FN5 — CID 123804717
5-(4-fluorophenyl)-6-methyl-N-(5-methyl-1H-pyrazol-3-yl)quinazolin-4-amine (PubChem CID 123804717) has the molecular formula C19H16FN5 and a molecular weight of 333.37 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-6-methyl-N-(5-methyl-1H-pyrazol-3-yl)quinazolin-4-amine.
| Compound Name | 5-(4-fluorophenyl)-6-methyl-N-(5-methyl-1H-pyrazol-3-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 123804717 |
| Molecular Formula | C19H16FN5 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 5-(4-fluorophenyl)-6-methyl-N-(5-methyl-1H-pyrazol-3-yl)quinazolin-4-amine |
| SMILES | Cc1cc(Nc2ncnc3ccc(C)c(-c4ccc(F)cc4)c23)n[nH]1 |
| InChI | InChI=1S/C19H16FN5/c1-11-3-8-15-18(17(11)13-4-6-14(20)7-5-13)19(22-10-21-15)23-16-9-12(2)24-25-16/h3-10H,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | ATEWLRRCBGVBSW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |