C16H15F3N2O9S — CID 123804781
(3,5,9,10,11-pentahydroxy-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl) 1,2,2-trifluoro-4-hydroxybutane-1-sulfonate (PubChem CID 123804781) has the molecular formula C16H15F3N2O9S and a molecular weight of 468.36 g/mol. Its IUPAC name is (3,5,9,10,11-pentahydroxy-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl) 1,2,2-trifluoro-4-hydroxybutane-1-sulfonate.
| Compound Name | (3,5,9,10,11-pentahydroxy-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl) 1,2,2-trifluoro-4-hydroxybutane-1-sulfonate |
|---|---|
| PubChem CID | 123804781 |
| Molecular Formula | C16H15F3N2O9S |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | (3,5,9,10,11-pentahydroxy-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl) 1,2,2-trifluoro-4-hydroxybutane-1-sulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)C1C=CC2c2c1c(O)n(O)c2O)C(F)C(F)(F)CCO |
| InChI | InChI=1S/C16H15F3N2O9S/c17-15(16(18,19)3-4-22)31(28,29)30-21-13(25)9-5-1-2-6(10(9)14(21)26)8-7(5)11(23)20(27)12(8)24/h1-2,5-6,15,22-27H,3-4H2 |
| InChIKey | YGBFMSFDPHTHSL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 174.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|