C12H5F15N2O3 — CID 123804876
3-[5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-oxadiazol-3-yl]propanoic acid (PubChem CID 123804876) has the molecular formula C12H5F15N2O3 and a molecular weight of 510.15 g/mol. Its IUPAC name is 3-[5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-oxadiazol-3-yl]propanoic acid.
| Compound Name | 3-[5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-oxadiazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 123804876 |
| Molecular Formula | C12H5F15N2O3 |
| Molecular Weight | 510.15 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | 3-[5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-oxadiazol-3-yl]propanoic acid |
| SMILES | O=C(O)CCc1noc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C12H5F15N2O3/c13-6(14,5-28-3(29-32-5)1-2-4(30)31)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27/h1-2H2,(H,30,31) |
| InChIKey | XJYXYYNRMAXABL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.15 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|