C24H33N8O+ — CID 123804952
[5-carbamoyl-6-[(5-imidazol-1-yl-3-pyridinyl)amino]-2-pyridinyl]-[2-(dimethylamino)cyclohexyl]-dimethylazanium (PubChem CID 123804952) has the molecular formula C24H33N8O+ and a molecular weight of 449.58 g/mol. Its IUPAC name is [5-carbamoyl-6-[(5-imidazol-1-yl-3-pyridinyl)amino]-2-pyridinyl]-[2-(dimethylamino)cyclohexyl]-dimethylazanium.
| Compound Name | [5-carbamoyl-6-[(5-imidazol-1-yl-3-pyridinyl)amino]-2-pyridinyl]-[2-(dimethylamino)cyclohexyl]-dimethylazanium |
|---|---|
| PubChem CID | 123804952 |
| Molecular Formula | C24H33N8O+ |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | [5-carbamoyl-6-[(5-imidazol-1-yl-3-pyridinyl)amino]-2-pyridinyl]-[2-(dimethylamino)cyclohexyl]-dimethylazanium |
| SMILES | CN(C)C1CCCCC1[N+](C)(C)c1ccc(C(N)=O)c(Nc2cncc(-n3ccnc3)c2)n1 |
| InChI | InChI=1S/C24H32N8O/c1-30(2)20-7-5-6-8-21(20)32(3,4)22-10-9-19(23(25)33)24(29-22)28-17-13-18(15-27-14-17)31-12-11-26-16-31/h9-16,20-21H,5-8H2,1-4H3,(H2-,25,28,29,33)/p+1 |
| InChIKey | ZEGURPSGPLYVRG-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|