C33H48O9 — CID 123805049
[6-[3,16-dihydroxy-9-(hydroxymethyl)-4,4,13,14-tetramethyl-2,11-dioxo-3,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methoxy-2-methyl-5-oxohept-3-en-2-yl] acetate (PubChem CID 123805049) has the molecular formula C33H48O9 and a molecular weight of 588.74 g/mol. Its IUPAC name is [6-[3,16-dihydroxy-9-(hydroxymethyl)-4,4,13,14-tetramethyl-2,11-dioxo-3,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methoxy-2-methyl-5-oxohept-3-en-2-yl] acetate.
| Compound Name | [6-[3,16-dihydroxy-9-(hydroxymethyl)-4,4,13,14-tetramethyl-2,11-dioxo-3,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methoxy-2-methyl-5-oxohept-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 123805049 |
| Molecular Formula | C33H48O9 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | [6-[3,16-dihydroxy-9-(hydroxymethyl)-4,4,13,14-tetramethyl-2,11-dioxo-3,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methoxy-2-methyl-5-oxohept-3-en-2-yl] acetate |
| SMILES | COC(C)(C(=O)C=CC(C)(C)OC(C)=O)C1C(O)CC2(C)C3CC=C4C(CC(=O)C(O)C4(C)C)C3(CO)C(=O)CC12C |
| InChI | InChI=1S/C33H48O9/c1-18(35)42-28(2,3)13-12-24(38)32(8,41-9)26-22(37)15-30(6)23-11-10-19-20(14-21(36)27(40)29(19,4)5)33(23,17-34)25(39)16-31(26,30)7/h10,12-13,20,22-23,26-27,34,37,40H,11,14-17H2,1-9H3 |
| InChIKey | GXWBDAAHGRSMTA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|