About 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane
5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane (PubChem CID 123805252) has the molecular formula C11H20N+
and a molecular weight of 166.29 g/mol. Its IUPAC name is 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane |
| PubChem CID | 123805252 |
| Molecular Formula | C11H20N+ |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.16 |
| IUPAC Name | 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane |
| SMILES | C=CC1C[N+]2(C)CCC1CC2C |
| InChI | InChI=1S/C11H20N/c1-4-10-8-12(3)6-5-11(10)7-9(12)2/h4,9-11H,1,5-8H2,2-3H3/q+1 |
| InChIKey | BFMRQDQJZPKDLP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane?
The IUPAC name of 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane (CID 123805252) is 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane.
What is the SMILES notation for 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane?
The canonical SMILES for 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane is C=CC1C[N+]2(C)CCC1CC2C.
What is the InChIKey of 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane?
The InChIKey is BFMRQDQJZPKDLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N/c1-4-10-8-12(3)6-5-11(10)7-9(12)2/h4,9-11H,1,5-8H2,2-3H3/q+1.
What are the key properties of 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane?
5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane has a molecular weight of 166.29 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-1,2-dimethyl-1-azoniabicyclo[2.2.2]octane is sourced from PubChem (CID 123805252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).