C21H25BrN2O2 — CID 123805477
tert-butyl 3-[N-(6-bromonaphthalen-2-yl)-C-methylcarbonimidoyl]pyrrolidine-1-carboxylate (PubChem CID 123805477) has the molecular formula C21H25BrN2O2 and a molecular weight of 417.35 g/mol. Its IUPAC name is tert-butyl 3-[N-(6-bromonaphthalen-2-yl)-C-methylcarbonimidoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[N-(6-bromonaphthalen-2-yl)-C-methylcarbonimidoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123805477 |
| Molecular Formula | C21H25BrN2O2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | tert-butyl 3-[N-(6-bromonaphthalen-2-yl)-C-methylcarbonimidoyl]pyrrolidine-1-carboxylate |
| SMILES | C/C(=N\c1ccc2cc(Br)ccc2c1)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H25BrN2O2/c1-14(17-9-10-24(13-17)20(25)26-21(2,3)4)23-19-8-6-15-11-18(22)7-5-16(15)12-19/h5-8,11-12,17H,9-10,13H2,1-4H3/b23-14+ |
| InChIKey | JNBNLWSTKQVDPO-OEAKJJBVSA-N |
| XLogP | 5.95 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|