C16H21N2O2P — CID 123805568
N-[aminomethyl-[(2-methylphenyl)methoxy]phosphoryl]-1-phenylmethanamine (PubChem CID 123805568) has the molecular formula C16H21N2O2P and a molecular weight of 304.33 g/mol. Its IUPAC name is N-[aminomethyl-[(2-methylphenyl)methoxy]phosphoryl]-1-phenylmethanamine.
| Compound Name | N-[aminomethyl-[(2-methylphenyl)methoxy]phosphoryl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 123805568 |
| Molecular Formula | C16H21N2O2P |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-[aminomethyl-[(2-methylphenyl)methoxy]phosphoryl]-1-phenylmethanamine |
| SMILES | Cc1ccccc1COP(=O)(CN)NCc1ccccc1 |
| InChI | InChI=1S/C16H21N2O2P/c1-14-7-5-6-10-16(14)12-20-21(19,13-17)18-11-15-8-3-2-4-9-15/h2-10H,11-13,17H2,1H3,(H,18,19) |
| InChIKey | XSNMEBXYYJMQGD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|