About 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium
8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium (PubChem CID 123807149) has the molecular formula C12H16N+
and a molecular weight of 174.27 g/mol. Its IUPAC name is 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium.
Molecular Properties
| Compound Name | 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium |
| PubChem CID | 123807149 |
| Molecular Formula | C12H16N+ |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium |
| SMILES | CCC1=c2c(ccc[n+]2C)=CCC1 |
| InChI | InChI=1S/C12H16N/c1-3-10-6-4-7-11-8-5-9-13(2)12(10)11/h5,7-9H,3-4,6H2,1-2H3/q+1 |
| InChIKey | JBBNLRDUXGIUJX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium?
The IUPAC name of 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium (CID 123807149) is 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium.
What is the SMILES notation for 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium?
The canonical SMILES for 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium is CCC1=c2c(ccc[n+]2C)=CCC1.
What is the InChIKey of 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium?
The InChIKey is JBBNLRDUXGIUJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N/c1-3-10-6-4-7-11-8-5-9-13(2)12(10)11/h5,7-9H,3-4,6H2,1-2H3/q+1.
What are the key properties of 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium?
8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium has a molecular weight of 174.27 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-1-methyl-6,7-dihydroquinolin-1-ium is sourced from PubChem (CID 123807149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).