C14H19N3 — CID 123807390
5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-pyrrolidin-2-yl-1H-imidazole (PubChem CID 123807390) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-pyrrolidin-2-yl-1H-imidazole.
| Compound Name | 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-pyrrolidin-2-yl-1H-imidazole |
|---|---|
| PubChem CID | 123807390 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-pyrrolidin-2-yl-1H-imidazole |
| SMILES | C=C/C=C\C(=C/C)c1cnc(C2CCCN2)[nH]1 |
| InChI | InChI=1S/C14H19N3/c1-3-5-7-11(4-2)13-10-16-14(17-13)12-8-6-9-15-12/h3-5,7,10,12,15H,1,6,8-9H2,2H3,(H,16,17)/b7-5-,11-4+ |
| InChIKey | APWAOJJOHJNNCD-WZXAJVQYSA-N |
| XLogP | 2.98 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|