C31H31FN6O7S — CID 123807402
[(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-[2-[3-(4-fluorophenyl)-4-(morpholin-4-ylmethyl)pyrazol-1-yl]pyridine-3-carbonyl]amino]methanesulfonic acid (PubChem CID 123807402) has the molecular formula C31H31FN6O7S and a molecular weight of 650.69 g/mol. Its IUPAC name is [(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-[2-[3-(4-fluorophenyl)-4-(morpholin-4-ylmethyl)pyrazol-1-yl]pyridine-3-carbonyl]amino]methanesulfonic acid.
| Compound Name | [(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-[2-[3-(4-fluorophenyl)-4-(morpholin-4-ylmethyl)pyrazol-1-yl]pyridine-3-carbonyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 123807402 |
| Molecular Formula | C31H31FN6O7S |
| Molecular Weight | 650.69 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | [(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-[2-[3-(4-fluorophenyl)-4-(morpholin-4-ylmethyl)pyrazol-1-yl]pyridine-3-carbonyl]amino]methanesulfonic acid |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)N(CS(=O)(=O)O)C(=O)c1cccnc1-n1cc(CN2CCOCC2)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C31H31FN6O7S/c32-24-10-8-22(9-11-24)27-23(18-36-13-15-45-16-14-36)19-38(35-27)30-25(7-4-12-34-30)31(41)37(20-46(42,43)44)26(28(39)29(33)40)17-21-5-2-1-3-6-21/h1-12,19,26H,13-18,20H2,(H2,33,40)(H,42,43,44) |
| InChIKey | ARUWQIMKHCAEOX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 178.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.69 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|