C25H37NO2Si — CID 123807630
tert-butyl-[[4-[2-(2,2-dimethylpropoxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane (PubChem CID 123807630) has the molecular formula C25H37NO2Si and a molecular weight of 411.66 g/mol. Its IUPAC name is tert-butyl-[[4-[2-(2,2-dimethylpropoxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[4-[2-(2,2-dimethylpropoxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 123807630 |
| Molecular Formula | C25H37NO2Si |
| Molecular Weight | 411.66 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | tert-butyl-[[4-[2-(2,2-dimethylpropoxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)COc1ncccc1-c1cccc2c1CCC2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H37NO2Si/c1-24(2,3)17-27-23-21(13-10-16-26-23)18-11-9-12-20-19(18)14-15-22(20)28-29(7,8)25(4,5)6/h9-13,16,22H,14-15,17H2,1-8H3 |
| InChIKey | HSXSFIJSEVDLEJ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.66 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|