C12H22N4 — CID 123807778
[2-(4-ethylpiperazin-1-yl)penta-2,4-dienylideneamino]methanamine (PubChem CID 123807778) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is [2-(4-ethylpiperazin-1-yl)penta-2,4-dienylideneamino]methanamine.
| Compound Name | [2-(4-ethylpiperazin-1-yl)penta-2,4-dienylideneamino]methanamine |
|---|---|
| PubChem CID | 123807778 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | [2-(4-ethylpiperazin-1-yl)penta-2,4-dienylideneamino]methanamine |
| SMILES | C=CC=C(C=NCN)N1CCN(CC)CC1 |
| InChI | InChI=1S/C12H22N4/c1-3-5-12(10-14-11-13)16-8-6-15(4-2)7-9-16/h3,5,10H,1,4,6-9,11,13H2,2H3 |
| InChIKey | UFZBXAJNQHMCOT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|