About N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid
N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid (PubChem CID 123807988) has the molecular formula C21H35NO8
and a molecular weight of 429.51 g/mol. Its IUPAC name is N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid.
Molecular Properties
| Compound Name | N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid |
| PubChem CID | 123807988 |
| Molecular Formula | C21H35NO8 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCOC(=O)/C=C\C(=O)O.CCN(CC)CC |
| InChI | InChI=1S/C15H20O8.C6H15N/c1-2-13(18)22-10-11-23-14(19)6-4-3-5-9-21-15(20)8-7-12(16)17;1-4-7(5-2)6-3/h2,7-8H,1,3-6,9-11H2,(H,16,17);4-6H2,1-3H3/b8-7-; |
| InChIKey | YZTWQDUZSAKQAL-CFYXSCKTSA-N |
| XLogP | 2.35 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid?
The IUPAC name of N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid (CID 123807988) is N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid.
What is the SMILES notation for N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid?
The canonical SMILES for N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid is C=CC(=O)OCCOC(=O)CCCCCOC(=O)/C=C\C(=O)O.CCN(CC)CC.
What is the InChIKey of N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid?
The InChIKey is YZTWQDUZSAKQAL-CFYXSCKTSA-N. The full InChI is InChI=1S/C15H20O8.C6H15N/c1-2-13(18)22-10-11-23-14(19)6-4-3-5-9-21-15(20)8-7-12(16)17;1-4-7(5-2)6-3/h2,7-8H,1,3-6,9-11H2,(H,16,17);4-6H2,1-3H3/b8-7-;.
What are the key properties of N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid?
N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid has a molecular weight of 429.51 g/mol, XLogP of 2.35, 15 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;(Z)-4-oxo-4-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]but-2-enoic acid is sourced from PubChem (CID 123807988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).