About (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one
(4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one (PubChem CID 123808144) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one.
Molecular Properties
| Compound Name | (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one |
| PubChem CID | 123808144 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one |
| SMILES | C=CC(=O)/C=C(\C)C1=C(C)CCC=N1 |
| InChI | InChI=1S/C12H15NO/c1-4-11(14)8-10(3)12-9(2)6-5-7-13-12/h4,7-8H,1,5-6H2,2-3H3/b10-8+ |
| InChIKey | PHQJSBWQSFSGEP-CSKARUKUSA-N |
| XLogP | 2.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one?
The IUPAC name of (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one (CID 123808144) is (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one.
What is the SMILES notation for (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one?
The canonical SMILES for (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one is C=CC(=O)/C=C(\C)C1=C(C)CCC=N1.
What is the InChIKey of (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one?
The InChIKey is PHQJSBWQSFSGEP-CSKARUKUSA-N. The full InChI is InChI=1S/C12H15NO/c1-4-11(14)8-10(3)12-9(2)6-5-7-13-12/h4,7-8H,1,5-6H2,2-3H3/b10-8+.
What are the key properties of (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one?
(4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one has a molecular weight of 189.26 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-5-(5-methyl-3,4-dihydropyridin-6-yl)hexa-1,4-dien-3-one is sourced from PubChem (CID 123808144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).