C17H16 — CID 123808150
3-methyl-1,8,8a,10a-tetrahydropyrene (PubChem CID 123808150) has the molecular formula C17H16 and a molecular weight of 220.31 g/mol. Its IUPAC name is 3-methyl-1,8,8a,10a-tetrahydropyrene.
| Compound Name | 3-methyl-1,8,8a,10a-tetrahydropyrene |
|---|---|
| PubChem CID | 123808150 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3-methyl-1,8,8a,10a-tetrahydropyrene |
| SMILES | CC1=CCC2C=CC3CC=Cc4ccc1c2c43 |
| InChI | InChI=1S/C17H16/c1-11-5-6-14-8-7-12-3-2-4-13-9-10-15(11)17(14)16(12)13/h2,4-5,7-10,12,14H,3,6H2,1H3 |
| InChIKey | APWICXKPSGUYRN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|