C9H12O6S — CID 123808483
3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-3-oxoprop-1-ene-1-sulfinic acid (PubChem CID 123808483) has the molecular formula C9H12O6S and a molecular weight of 248.26 g/mol. Its IUPAC name is 3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-3-oxoprop-1-ene-1-sulfinic acid.
| Compound Name | 3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-3-oxoprop-1-ene-1-sulfinic acid |
|---|---|
| PubChem CID | 123808483 |
| Molecular Formula | C9H12O6S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-3-oxoprop-1-ene-1-sulfinic acid |
| SMILES | O=C(C=CS(=O)O)OC1COC2CCOC21 |
| InChI | InChI=1S/C9H12O6S/c10-8(2-4-16(11)12)15-7-5-14-6-1-3-13-9(6)7/h2,4,6-7,9H,1,3,5H2,(H,11,12) |
| InChIKey | RAFWEAWGICBDNK-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|