C26H33ClO6 — CID 123808620
[(1S,2R,5R,6R,7S,10R)-10-(2-hydroxyacetyl)oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl] 3-(4-chlorophenyl)prop-2-enoate (PubChem CID 123808620) has the molecular formula C26H33ClO6 and a molecular weight of 477.00 g/mol. Its IUPAC name is [(1S,2R,5R,6R,7S,10R)-10-(2-hydroxyacetyl)oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl] 3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [(1S,2R,5R,6R,7S,10R)-10-(2-hydroxyacetyl)oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl] 3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 123808620 |
| Molecular Formula | C26H33ClO6 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [(1S,2R,5R,6R,7S,10R)-10-(2-hydroxyacetyl)oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl] 3-(4-chlorophenyl)prop-2-enoate |
| SMILES | CC(C)C12C[C@@H](OC(=O)CO)[C@@](C)(O1)[C@@H]1CC[C@@H](C)[C@H]1[C@@H]2OC(=O)C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H33ClO6/c1-15(2)26-13-20(31-22(30)14-28)25(4,33-26)19-11-5-16(3)23(19)24(26)32-21(29)12-8-17-6-9-18(27)10-7-17/h6-10,12,15-16,19-20,23-24,28H,5,11,13-14H2,1-4H3/t16-,19-,20-,23-,24+,25+,26?/m1/s1 |
| InChIKey | FABFBWLCDDLRSJ-UVOFFPCMSA-N |
| XLogP | 4.42 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|