C19H21FO3 — CID 123808660
(1R,2S,6R,7S)-1-(fluoromethyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123808660) has the molecular formula C19H21FO3 and a molecular weight of 316.37 g/mol. Its IUPAC name is (1R,2S,6R,7S)-1-(fluoromethyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-1-(fluoromethyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123808660 |
| Molecular Formula | C19H21FO3 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (1R,2S,6R,7S)-1-(fluoromethyl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1cc(C)c(C2C(=O)[C@H]3[C@@H]4CC[C@@](CF)(O4)[C@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C19H21FO3/c1-9-6-10(2)13(11(3)7-9)15-17(21)14-12-4-5-19(8-20,23-12)16(14)18(15)22/h6-7,12,14-16H,4-5,8H2,1-3H3/t12-,14-,15?,16+,19-/m0/s1 |
| InChIKey | XZYUQYVESQQWKS-JACWOMTRSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|