C14H29NOS — CID 123808890
5-(2,2,4,4-tetramethylpentylsulfanylmethyl)pyrrolidin-2-ol (PubChem CID 123808890) has the molecular formula C14H29NOS and a molecular weight of 259.46 g/mol. Its IUPAC name is 5-(2,2,4,4-tetramethylpentylsulfanylmethyl)pyrrolidin-2-ol.
| Compound Name | 5-(2,2,4,4-tetramethylpentylsulfanylmethyl)pyrrolidin-2-ol |
|---|---|
| PubChem CID | 123808890 |
| Molecular Formula | C14H29NOS |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 5-(2,2,4,4-tetramethylpentylsulfanylmethyl)pyrrolidin-2-ol |
| SMILES | CC(C)(C)CC(C)(C)CSCC1CCC(O)N1 |
| InChI | InChI=1S/C14H29NOS/c1-13(2,3)9-14(4,5)10-17-8-11-6-7-12(16)15-11/h11-12,15-16H,6-10H2,1-5H3 |
| InChIKey | PBMSMZHVGNICNV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |