C24H15Cl2F5N6O — CID 123808897
4-(2-chloro-6-fluorophenyl)-N-(4-chlorophenyl)-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]-1,3,5-triazin-2-amine (PubChem CID 123808897) has the molecular formula C24H15Cl2F5N6O and a molecular weight of 569.32 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-N-(4-chlorophenyl)-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-N-(4-chlorophenyl)-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123808897 |
| Molecular Formula | C24H15Cl2F5N6O |
| Molecular Weight | 569.32 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-N-(4-chlorophenyl)-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]-1,3,5-triazin-2-amine |
| SMILES | Fc1cccc(Cl)c1-c1nc(/N=N/Cc2ccc(OC(F)(F)C(F)F)cc2)nc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C24H15Cl2F5N6O/c25-14-6-8-15(9-7-14)33-22-34-20(19-17(26)2-1-3-18(19)27)35-23(36-22)37-32-12-13-4-10-16(11-5-13)38-24(30,31)21(28)29/h1-11,21H,12H2,(H,33,34,35,36)/b37-32+ |
| InChIKey | QPQQWJZHDGFOBC-BQNXFWFHSA-N |
| XLogP | 8.25 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.32 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|