C21H32BN3O3 — CID 123809246
2-methyl-5-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]methyl]piperidin-4-yl]-1,3,4-oxadiazole (PubChem CID 123809246) has the molecular formula C21H32BN3O3 and a molecular weight of 385.32 g/mol. Its IUPAC name is 2-methyl-5-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]methyl]piperidin-4-yl]-1,3,4-oxadiazole.
| Compound Name | 2-methyl-5-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]methyl]piperidin-4-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 123809246 |
| Molecular Formula | C21H32BN3O3 |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 2-methyl-5-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]methyl]piperidin-4-yl]-1,3,4-oxadiazole |
| SMILES | Cc1nnc(C2CCN(CC3C=CC(B4OC(C)(C)C(C)(C)O4)=CC3)CC2)o1 |
| InChI | InChI=1S/C21H32BN3O3/c1-15-23-24-19(26-15)17-10-12-25(13-11-17)14-16-6-8-18(9-7-16)22-27-20(2,3)21(4,5)28-22/h6,8-9,16-17H,7,10-14H2,1-5H3 |
| InChIKey | CSMJSYUCGFTKOW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|