About 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine
6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine (PubChem CID 123809506) has the molecular formula C8H8BrN
and a molecular weight of 198.06 g/mol. Its IUPAC name is 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine |
| PubChem CID | 123809506 |
| Molecular Formula | C8H8BrN |
| Molecular Weight | 198.06 g/mol |
| Exact Mass | 196.98 |
| IUPAC Name | 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine |
| SMILES | C=c1cc(N)c(Br)cc1=C |
| InChI | InChI=1S/C8H8BrN/c1-5-3-7(9)8(10)4-6(5)2/h3-4H,1-2,10H2 |
| InChIKey | JGUKQGXCDWAXII-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.06 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine?
The IUPAC name of 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine (CID 123809506) is 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine?
The canonical SMILES for 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine is C=c1cc(N)c(Br)cc1=C.
What is the InChIKey of 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine?
The InChIKey is JGUKQGXCDWAXII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN/c1-5-3-7(9)8(10)4-6(5)2/h3-4H,1-2,10H2.
What are the key properties of 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine?
6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine has a molecular weight of 198.06 g/mol, XLogP of 0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3,4-dimethylidenecyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 123809506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).