C25H33ClN6O3Si — CID 123809580
N-[1-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]propan-2-yl]-2-[(1S)-1-hydroxyethyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carboxamide (PubChem CID 123809580) has the molecular formula C25H33ClN6O3Si and a molecular weight of 529.12 g/mol. Its IUPAC name is N-[1-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]propan-2-yl]-2-[(1S)-1-hydroxyethyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carboxamide.
| Compound Name | N-[1-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]propan-2-yl]-2-[(1S)-1-hydroxyethyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 123809580 |
| Molecular Formula | C25H33ClN6O3Si |
| Molecular Weight | 529.12 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | N-[1-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]propan-2-yl]-2-[(1S)-1-hydroxyethyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carboxamide |
| SMILES | CC(Cn1ccc(-c2ccc(C#N)c(Cl)c2)n1)NC(=O)c1cn(COCC[Si](C)(C)C)c([C@H](C)O)n1 |
| InChI | InChI=1S/C25H33ClN6O3Si/c1-17(14-32-9-8-22(30-32)19-6-7-20(13-27)21(26)12-19)28-25(34)23-15-31(24(29-23)18(2)33)16-35-10-11-36(3,4)5/h6-9,12,15,17-18,33H,10-11,14,16H2,1-5H3,(H,28,34)/t17?,18-/m0/s1 |
| InChIKey | QIECJZNFWXBOCL-ZVAWYAOSSA-N |
| XLogP | 4.46 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.12 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|