C26H30N4O2 — CID 123809968
N-[2,2-dimethyl-3-(1-quinolin-2-ylethylideneamino)oxypropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 123809968) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(1-quinolin-2-ylethylideneamino)oxypropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | N-[2,2-dimethyl-3-(1-quinolin-2-ylethylideneamino)oxypropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 123809968 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-[2,2-dimethyl-3-(1-quinolin-2-ylethylideneamino)oxypropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | CC(=NOCC(C)(C)CON=C1CCCc2ccc(C)nc21)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C26H30N4O2/c1-18-12-13-21-9-7-11-24(25(21)27-18)30-32-17-26(3,4)16-31-29-19(2)22-15-14-20-8-5-6-10-23(20)28-22/h5-6,8,10,12-15H,7,9,11,16-17H2,1-4H3 |
| InChIKey | KYJQZKKXIZHNTM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|