C22H17F2N3O3S — CID 123810250
N-[5-[1-[(2,6-difluorophenyl)methyl]-2,3-dioxocyclopropyl]-4-propan-2-yl-1,3-thiazol-2-yl]pyridine-2-carboxamide (PubChem CID 123810250) has the molecular formula C22H17F2N3O3S and a molecular weight of 441.46 g/mol. Its IUPAC name is N-[5-[1-[(2,6-difluorophenyl)methyl]-2,3-dioxocyclopropyl]-4-propan-2-yl-1,3-thiazol-2-yl]pyridine-2-carboxamide.
| Compound Name | N-[5-[1-[(2,6-difluorophenyl)methyl]-2,3-dioxocyclopropyl]-4-propan-2-yl-1,3-thiazol-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123810250 |
| Molecular Formula | C22H17F2N3O3S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N-[5-[1-[(2,6-difluorophenyl)methyl]-2,3-dioxocyclopropyl]-4-propan-2-yl-1,3-thiazol-2-yl]pyridine-2-carboxamide |
| SMILES | CC(C)c1nc(NC(=O)c2ccccn2)sc1C1(Cc2c(F)cccc2F)C(=O)C1=O |
| InChI | InChI=1S/C22H17F2N3O3S/c1-11(2)16-19(31-21(26-16)27-20(30)15-8-3-4-9-25-15)22(17(28)18(22)29)10-12-13(23)6-5-7-14(12)24/h3-9,11H,10H2,1-2H3,(H,26,27,30) |
| InChIKey | FZCXPVCIFZKOME-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|