C20H23F3N2O4 — CID 123810472
N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-4,5-dioxo-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxamide (PubChem CID 123810472) has the molecular formula C20H23F3N2O4 and a molecular weight of 412.41 g/mol. Its IUPAC name is N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-4,5-dioxo-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-4,5-dioxo-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123810472 |
| Molecular Formula | C20H23F3N2O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-4,5-dioxo-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxamide |
| SMILES | CC1(C)CC(NC(=O)C2CN(CCCC(F)(F)F)C(=O)C2=O)c2ccccc2O1 |
| InChI | InChI=1S/C20H23F3N2O4/c1-19(2)10-14(12-6-3-4-7-15(12)29-19)24-17(27)13-11-25(18(28)16(13)26)9-5-8-20(21,22)23/h3-4,6-7,13-14H,5,8-11H2,1-2H3,(H,24,27) |
| InChIKey | INCLZEABEKRYFU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|