C13H20O3 — CID 123810542
1-(2-hydroxyethoxy)-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one (PubChem CID 123810542) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(2-hydroxyethoxy)-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one.
| Compound Name | 1-(2-hydroxyethoxy)-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one |
|---|---|
| PubChem CID | 123810542 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-(2-hydroxyethoxy)-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one |
| SMILES | C=C1C(=O)CCC2(C)C(OCCO)CCC12 |
| InChI | InChI=1S/C13H20O3/c1-9-10-3-4-12(16-8-7-14)13(10,2)6-5-11(9)15/h10,12,14H,1,3-8H2,2H3 |
| InChIKey | JWADPVOVOKERDT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|