C17H24O6 — CID 123810700
6-O-(2-methylbut-2-enoyl) 1-O-(oxolan-2-ylmethyl) 2-methylhex-2-enedioate (PubChem CID 123810700) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is 6-O-(2-methylbut-2-enoyl) 1-O-(oxolan-2-ylmethyl) 2-methylhex-2-enedioate.
| Compound Name | 6-O-(2-methylbut-2-enoyl) 1-O-(oxolan-2-ylmethyl) 2-methylhex-2-enedioate |
|---|---|
| PubChem CID | 123810700 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 6-O-(2-methylbut-2-enoyl) 1-O-(oxolan-2-ylmethyl) 2-methylhex-2-enedioate |
| SMILES | CC=C(C)C(=O)OC(=O)CCC=C(C)C(=O)OCC1CCCO1 |
| InChI | InChI=1S/C17H24O6/c1-4-12(2)17(20)23-15(18)9-5-7-13(3)16(19)22-11-14-8-6-10-21-14/h4,7,14H,5-6,8-11H2,1-3H3 |
| InChIKey | JUEHTVADIHSONO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|