C31H26FN5O2 — CID 123810788
12-ethyl-8-[3-(4-fluorophenyl)phenyl]-11-(4-methoxyphenyl)imino-3,4,8,10-tetrazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),4,9-tetraen-7-one (PubChem CID 123810788) has the molecular formula C31H26FN5O2 and a molecular weight of 519.58 g/mol. Its IUPAC name is 12-ethyl-8-[3-(4-fluorophenyl)phenyl]-11-(4-methoxyphenyl)imino-3,4,8,10-tetrazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),4,9-tetraen-7-one.
| Compound Name | 12-ethyl-8-[3-(4-fluorophenyl)phenyl]-11-(4-methoxyphenyl)imino-3,4,8,10-tetrazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),4,9-tetraen-7-one |
|---|---|
| PubChem CID | 123810788 |
| Molecular Formula | C31H26FN5O2 |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 12-ethyl-8-[3-(4-fluorophenyl)phenyl]-11-(4-methoxyphenyl)imino-3,4,8,10-tetrazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),4,9-tetraen-7-one |
| SMILES | CCC1CC=c2c(n(-c3cccc(-c4ccc(F)cc4)c3)c(=O)c3cn[nH]c23)=N/C1=N/c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H26FN5O2/c1-3-19-9-16-26-28-27(18-33-36-28)31(38)37(24-6-4-5-21(17-24)20-7-10-22(32)11-8-20)30(26)35-29(19)34-23-12-14-25(39-2)15-13-23/h4-8,10-19H,3,9H2,1-2H3,(H,33,36)/b34-29+ |
| InChIKey | SLTVRRRAKMGZLE-RIHQVDFKSA-N |
| XLogP | 5.09 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|