C23H34N2O2S — CID 123810863
S-[3-(2-adamantylamino)-3-oxopropyl] 3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbothioate (PubChem CID 123810863) has the molecular formula C23H34N2O2S and a molecular weight of 402.60 g/mol. Its IUPAC name is S-[3-(2-adamantylamino)-3-oxopropyl] 3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbothioate.
| Compound Name | S-[3-(2-adamantylamino)-3-oxopropyl] 3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbothioate |
|---|---|
| PubChem CID | 123810863 |
| Molecular Formula | C23H34N2O2S |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | S-[3-(2-adamantylamino)-3-oxopropyl] 3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbothioate |
| SMILES | O=C(CCSC(=O)N1CCCC2CCCC=C21)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H34N2O2S/c26-21(24-22-18-11-15-10-16(13-18)14-19(22)12-15)7-9-28-23(27)25-8-3-5-17-4-1-2-6-20(17)25/h6,15-19,22H,1-5,7-14H2,(H,24,26) |
| InChIKey | DEXRHVLIBXEASY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|