C19H24N6O3S — CID 123811390
N-[[3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methylidene]morpholine-4-sulfonamide (PubChem CID 123811390) has the molecular formula C19H24N6O3S and a molecular weight of 416.51 g/mol. Its IUPAC name is N-[[3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methylidene]morpholine-4-sulfonamide.
| Compound Name | N-[[3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methylidene]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 123811390 |
| Molecular Formula | C19H24N6O3S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-[[3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methylidene]morpholine-4-sulfonamide |
| SMILES | CC1CC(C=NS(=O)(=O)N2CCOCC2)CC1c1cnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C19H24N6O3S/c1-13-8-14(10-23-29(26,27)24-4-6-28-7-5-24)9-15(13)17-11-21-18-12-22-19-16(25(17)18)2-3-20-19/h2-3,10-15,20H,4-9H2,1H3 |
| InChIKey | LIQALXOPAPLOFQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|