C19H23F3N6O2S — CID 123811476
N-[3-methyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-2-(trifluoromethyl)pyrrolidine-1-sulfonamide (PubChem CID 123811476) has the molecular formula C19H23F3N6O2S and a molecular weight of 456.49 g/mol. Its IUPAC name is N-[3-methyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-2-(trifluoromethyl)pyrrolidine-1-sulfonamide.
| Compound Name | N-[3-methyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-2-(trifluoromethyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 123811476 |
| Molecular Formula | C19H23F3N6O2S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | N-[3-methyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-2-(trifluoromethyl)pyrrolidine-1-sulfonamide |
| SMILES | CC1CC(NS(=O)(=O)N2CCCC2C(F)(F)F)CC1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C19H23F3N6O2S/c1-11-7-12(26-31(29,30)27-6-2-3-16(27)19(20,21)22)8-14(11)18-25-10-13-9-24-17-15(28(13)18)4-5-23-17/h4-5,9-12,14,16,23,26H,2-3,6-8H2,1H3 |
| InChIKey | QYOLDKCVKRMVRI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |